Products 1421283-57-9
CAS 1421283-57-9 appears in our catalog under these names: Fosinopril Impurity 2, Fosinopril Sodium Impurity 20. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2S,4S)-4-cyclohexyl-1-propanoylpyrrolidine-2-carboxylic acid (CAS 1421283-57-9) is a chemical compound with the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. IUPAC name: (2S,4S)-4-cyclohexyl-1-propanoylpyrrolidine-2-carboxylic acid. InChIKey: FNDUAIAJNMDGCJ-NEPJUHHUSA-N.
| Molecular formula | C14H23NO3 |
|---|---|
| Molecular weight | 253.34 g/mol |
| IUPAC name | (2S,4S)-4-cyclohexyl-1-propanoylpyrrolidine-2-carboxylic acid |
| InChIKey | FNDUAIAJNMDGCJ-NEPJUHHUSA-N |
| SMILES | CCC(=O)N1C[C@@H](C[C@H]1C(=O)O)C2CCCCC2 |
Computed by PubChem (NCBI)