Products 1421322-61-3
CAS 1421322-61-3 is the registry number for 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)aniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)aniline (CAS 1421322-61-3) is a chemical compound with the molecular formula C13H17BF3NO2 and a molecular weight of 287.09 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)aniline. InChIKey: NFAYRARHQJNDCS-UHFFFAOYSA-N.
| Molecular formula | C13H17BF3NO2 |
|---|---|
| Molecular weight | 287.09 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)aniline |
| InChIKey | NFAYRARHQJNDCS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)