Products 1704068-89-2
CAS 1704068-89-2 appears in our catalog under these names: (3–(4–Methylpiperidin–1–yl)–5–(trifluoromethyl)phenyl)boronic acid, (3-(4-methylpiperidin-1-yl)-5-(trifluoromethyl)phenyl)boronic acid, >95%, >95%, (3-(4-methylpiperidin-1-yl)-5-(trifluoromethyl)phenyl)boronic acid, 95%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g.
[3-(4-methylpiperidin-1-yl)-5-(trifluoromethyl)phenyl]boronic acid (CAS 1704068-89-2) is a chemical compound with the molecular formula C13H17BF3NO2 and a molecular weight of 287.09 g/mol. IUPAC name: [3-(4-methylpiperidin-1-yl)-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: UTQKLQUCWNPURS-UHFFFAOYSA-N.
| Molecular formula | C13H17BF3NO2 |
|---|---|
| Molecular weight | 287.09 g/mol |
| IUPAC name | [3-(4-methylpiperidin-1-yl)-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | UTQKLQUCWNPURS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)N2CCC(CC2)C)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)