CAS 1421601-06-0 appears in our catalog under these names: 5-Bromo-2-furansulfonyl chloride, 5-Bromofuran-2-sulfonyl chloride, 95%, 5-Bromofuran-2-sulfonyl chloride. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 750mg, 1g, 50mg, 0,5g.
5-bromofuran-2-sulfonyl chloride (CAS 1421601-06-0) is a chemical compound with the molecular formula C4H2BrClO3S and a molecular weight of 245.48 g/mol. IUPAC name: 5-bromofuran-2-sulfonyl chloride. InChIKey: AUKOCFUBKYOEEL-UHFFFAOYSA-N.
| Molecular formula | C4H2BrClO3S |
|---|---|
| Molecular weight | 245.48 g/mol |
| IUPAC name | 5-bromofuran-2-sulfonyl chloride |
| InChIKey | AUKOCFUBKYOEEL-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)