Products 1421601-06-0

CAS 1421601-06-0 appears in our catalog under these names: 5-Bromo-2-furansulfonyl chloride, 5-Bromofuran-2-sulfonyl chloride, 95%, 5-Bromofuran-2-sulfonyl chloride. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 750mg, 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-bromofuran-2-sulfonyl chloride (CAS 1421601-06-0) is a chemical compound with the molecular formula C4H2BrClO3S and a molecular weight of 245.48 g/mol. IUPAC name: 5-bromofuran-2-sulfonyl chloride. InChIKey: AUKOCFUBKYOEEL-UHFFFAOYSA-N.

Identity
Molecular formulaC4H2BrClO3S
Molecular weight245.48 g/mol
IUPAC name5-bromofuran-2-sulfonyl chloride
InChIKeyAUKOCFUBKYOEEL-UHFFFAOYSA-N
SMILESC1=C(OC(=C1)Br)S(=O)(=O)Cl

Computed by PubChem (NCBI)