Products 930111-08-3

CAS 930111-08-3 appears in our catalog under these names: 3-Bromofuran-2-sulfonyl chloride, 3-Bromofuran-2-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.

3-bromofuran-2-sulfonyl chloride (CAS 930111-08-3) is a chemical compound with the molecular formula C4H2BrClO3S and a molecular weight of 245.48 g/mol. IUPAC name: 3-bromofuran-2-sulfonyl chloride. InChIKey: UOXQKPHFCTWWFP-UHFFFAOYSA-N.

Identity
Molecular formulaC4H2BrClO3S
Molecular weight245.48 g/mol
IUPAC name3-bromofuran-2-sulfonyl chloride
InChIKeyUOXQKPHFCTWWFP-UHFFFAOYSA-N
SMILESC1=COC(=C1Br)S(=O)(=O)Cl

Computed by PubChem (NCBI)