CAS 1421747-19-4 appears in our catalog under these names: Lorcaserin N-Oxide, N-Hydroxy lorcaserin. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg.
(5R)-7-chloro-3-hydroxy-5-methyl-1,2,4,5-tetrahydro-3-benzazepine (CAS 1421747-19-4) is a chemical compound with the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. IUPAC name: (5R)-7-chloro-3-hydroxy-5-methyl-1,2,4,5-tetrahydro-3-benzazepine. InChIKey: OBKJFJJRKLOMQV-QMMMGPOBSA-N.
| Molecular formula | C11H14ClNO |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | (5R)-7-chloro-3-hydroxy-5-methyl-1,2,4,5-tetrahydro-3-benzazepine |
| InChIKey | OBKJFJJRKLOMQV-QMMMGPOBSA-N |
| SMILES | C[C@H]1CN(CCC2=C1C=C(C=C2)Cl)O |
Computed by PubChem (NCBI)