CAS 14219-31-9 is the registry number for Iminodiacetate copper(2+), 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper 2-(carboxylatomethylamino)acetate (CAS 14219-31-9) is a chemical compound with the molecular formula C4H5CuNO4 and a molecular weight of 194.63 g/mol. IUPAC name: copper 2-(carboxylatomethylamino)acetate. InChIKey: KBRWUTUSBJVEEN-UHFFFAOYSA-L.
| Molecular formula | C4H5CuNO4 |
|---|---|
| Molecular weight | 194.63 g/mol |
| IUPAC name | copper 2-(carboxylatomethylamino)acetate |
| InChIKey | KBRWUTUSBJVEEN-UHFFFAOYSA-L |
| SMILES | C(C(=O)[O-])NCC(=O)[O-].[Cu+2] |
Computed by PubChem (NCBI)