Products 30272-90-3
CAS 30272-90-3 is the registry number for Copper, (L-aspartato)-, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper (2S)-2-aminobutanedioate (CAS 30272-90-3) is a chemical compound with the molecular formula C4H5CuNO4 and a molecular weight of 194.63 g/mol. IUPAC name: copper (2S)-2-aminobutanedioate. InChIKey: LHBCBDOIAVIYJI-DKWTVANSSA-L.
| Molecular formula | C4H5CuNO4 |
|---|---|
| Molecular weight | 194.63 g/mol |
| IUPAC name | copper (2S)-2-aminobutanedioate |
| InChIKey | LHBCBDOIAVIYJI-DKWTVANSSA-L |
| SMILES | C([C@@H](C(=O)[O-])N)C(=O)[O-].[Cu+2] |
Computed by PubChem (NCBI)
Synonyms:
(L-Aspartato(2-)-kappaN,kappaO1,kappaO4)copper, [L-Aspartato(2-)-kappaN,kappaO1,kappaO4]copper, Copper L-aspartate, COPPER ASPARTATE, Copper, (L-aspartato)-, Copper, (L-aspartato(2-))-, L-Aspartic acid, copper(2) salt, Copper, (L-aspartato(2-)-kappan,kappao1,kappao4)-, Copper(2+) (2S)-2-aminobutanedioate