CAS 1422057-35-9 appears in our catalog under these names: 5-(Aminomethyl)isoindolin-1-one Hydrochloride, 5–(Aminomethyl)isoindolin–1–one hydrochloride, 5-(Aminomethyl)isoindolin-1-one hydrochloride, 95%, 95%, 5-(Aminomethyl)isoindolin-1-one hydrochloride, 95%. Offered by: TRC, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 50mg, 0,5g.
5-(aminomethyl)-2,3-dihydroisoindol-1-one;hydrochloride (CAS 1422057-35-9) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: 5-(aminomethyl)-2,3-dihydroisoindol-1-one;hydrochloride. InChIKey: VZQKBHBQOZPPRR-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 5-(aminomethyl)-2,3-dihydroisoindol-1-one;hydrochloride |
| InChIKey | VZQKBHBQOZPPRR-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)CN)C(=O)N1.Cl |
Computed by PubChem (NCBI)