Products 1422209-78-6
CAS 1422209-78-6 appears in our catalog under these names: 7-bromo-1-methyl-quinazoline-2,4-dione, 97%, 97%, 7-BROMO-1-METHYL-QUINAZOLINE-2,4-DIONE, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
7-bromo-1-methylquinazoline-2,4-dione (CAS 1422209-78-6) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: 7-bromo-1-methylquinazoline-2,4-dione. InChIKey: UMHHDXUCBLSXFL-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 7-bromo-1-methylquinazoline-2,4-dione |
| InChIKey | UMHHDXUCBLSXFL-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)Br)C(=O)NC1=O |
Computed by PubChem (NCBI)