CAS 142231-05-8 appears in our catalog under these names: Ketorolac Impurity 58, 4-Bromo-2-benzoylpyrrole. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
(4-bromo-1H-pyrrol-2-yl)-phenylmethanone (CAS 142231-05-8) is a chemical compound with the molecular formula C11H8BrNO and a molecular weight of 250.09 g/mol. IUPAC name: (4-bromo-1H-pyrrol-2-yl)-phenylmethanone. InChIKey: MFIQIUWWTVDWPH-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO |
|---|---|
| Molecular weight | 250.09 g/mol |
| IUPAC name | (4-bromo-1H-pyrrol-2-yl)-phenylmethanone |
| InChIKey | MFIQIUWWTVDWPH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=CN2)Br |
Computed by PubChem (NCBI)