CAS 1422386-61-5 appears in our catalog under these names: 3-(3-Chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid, 98%, 3-(3-Chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-(3-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CAS 1422386-61-5) is a chemical compound with the molecular formula C10H7ClFNO3 and a molecular weight of 243.62 g/mol. IUPAC name: 3-(3-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. InChIKey: SCIPKLWSXIIFHA-UHFFFAOYSA-N.
| Molecular formula | C10H7ClFNO3 |
|---|---|
| Molecular weight | 243.62 g/mol |
| IUPAC name | 3-(3-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| InChIKey | SCIPKLWSXIIFHA-UHFFFAOYSA-N |
| SMILES | C1C(ON=C1C2=C(C(=CC=C2)Cl)F)C(=O)O |
Computed by PubChem (NCBI)