CAS 2068150-95-6 is the registry number for 3-(3-Chloro-2-fluorophenyl)-2,5-dihydroisoxazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-chloro-2-fluorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid (CAS 2068150-95-6) is a chemical compound with the molecular formula C10H7ClFNO3 and a molecular weight of 243.62 g/mol. IUPAC name: 3-(3-chloro-2-fluorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid. InChIKey: XIBXKFCMPISNNZ-UHFFFAOYSA-N.
| Molecular formula | C10H7ClFNO3 |
|---|---|
| Molecular weight | 243.62 g/mol |
| IUPAC name | 3-(3-chloro-2-fluorophenyl)-2,5-dihydro-1,2-oxazole-5-carboxylic acid |
| InChIKey | XIBXKFCMPISNNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)F)C2=CC(ON2)C(=O)O |
Computed by PubChem (NCBI)