Products 142288-22-0

CAS 142288-22-0 is the registry number for 1,2,4-Benzenetricarboxylic Acid 1,2-Dihexyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.

Structural formula: {0} (CAS {1})

3,4-bis(hexoxycarbonyl)benzoic acid (CAS 142288-22-0) is a chemical compound with the molecular formula C21H30O6 and a molecular weight of 378.5 g/mol. IUPAC name: 3,4-bis(hexoxycarbonyl)benzoic acid. InChIKey: VHZJXSVRRUNKIR-UHFFFAOYSA-N.

Identity
Molecular formulaC21H30O6
Molecular weight378.5 g/mol
IUPAC name3,4-bis(hexoxycarbonyl)benzoic acid
InChIKeyVHZJXSVRRUNKIR-UHFFFAOYSA-N
SMILESCCCCCCOC(=O)C1=C(C=C(C=C1)C(=O)O)C(=O)OCCCCCC

Computed by PubChem (NCBI)