CAS 1423017-97-3 is the registry number for Pz-pro-oh, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2S)-1-[(4-phenyldiazenylphenyl)methoxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 1423017-97-3) is a chemical compound with the molecular formula C19H19N3O4 and a molecular weight of 353.4 g/mol. IUPAC name: (2S)-1-[(4-phenyldiazenylphenyl)methoxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: ZMZPSHULEFQAGI-KRWDZBQOSA-N.
| Molecular formula | C19H19N3O4 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (2S)-1-[(4-phenyldiazenylphenyl)methoxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | ZMZPSHULEFQAGI-KRWDZBQOSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2=CC=C(C=C2)N=NC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)