Products 194541-47-4

CAS 194541-47-4 is the registry number for Pz-Pro-OH. Offered by: Creative Peptides. Available pack sizes: 5g, 25g.

Structural formula: {0} (CAS {1})

1-[(4-phenyldiazenylphenyl)methoxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 194541-47-4) is a chemical compound with the molecular formula C19H19N3O4 and a molecular weight of 353.4 g/mol. IUPAC name: 1-[(4-phenyldiazenylphenyl)methoxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: ZMZPSHULEFQAGI-UHFFFAOYSA-N.

Identity
Molecular formulaC19H19N3O4
Molecular weight353.4 g/mol
IUPAC name1-[(4-phenyldiazenylphenyl)methoxycarbonyl]pyrrolidine-2-carboxylic acid
InChIKeyZMZPSHULEFQAGI-UHFFFAOYSA-N
SMILESC1CC(N(C1)C(=O)OCC2=CC=C(C=C2)N=NC3=CC=CC=C3)C(=O)O

Computed by PubChem (NCBI)