CAS 1423024-39-8 is the registry number for 2-Amino-3-(4-bromo-1H-indol-3-yl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-amino-3-(4-bromo-1H-indol-3-yl)propanoic acid;hydrochloride (CAS 1423024-39-8) is a chemical compound with the molecular formula C11H12BrClN2O2 and a molecular weight of 319.58 g/mol. IUPAC name: 2-amino-3-(4-bromo-1H-indol-3-yl)propanoic acid;hydrochloride. InChIKey: SFXYTOLDAIQWCB-UHFFFAOYSA-N.
| Molecular formula | C11H12BrClN2O2 |
|---|---|
| Molecular weight | 319.58 g/mol |
| IUPAC name | 2-amino-3-(4-bromo-1H-indol-3-yl)propanoic acid;hydrochloride |
| InChIKey | SFXYTOLDAIQWCB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=CN2)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)