Products 1423024-39-8

CAS 1423024-39-8 is the registry number for 2-Amino-3-(4-bromo-1H-indol-3-yl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

2-amino-3-(4-bromo-1H-indol-3-yl)propanoic acid;hydrochloride (CAS 1423024-39-8) is a chemical compound with the molecular formula C11H12BrClN2O2 and a molecular weight of 319.58 g/mol. IUPAC name: 2-amino-3-(4-bromo-1H-indol-3-yl)propanoic acid;hydrochloride. InChIKey: SFXYTOLDAIQWCB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12BrClN2O2
Molecular weight319.58 g/mol
IUPAC name2-amino-3-(4-bromo-1H-indol-3-yl)propanoic acid;hydrochloride
InChIKeySFXYTOLDAIQWCB-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)Br)C(=CN2)CC(C(=O)O)N.Cl

Computed by PubChem (NCBI)