CAS 756859-07-1 appears in our catalog under these names: N-{((4-bromo-2-methylphenyl)carbamoyl)methyl}-2-chloroacetamide, 95%, N-{((4-Bromo-2-methylphenyl)carbamoyl)methyl}-2-chloroacetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
N-(4-bromo-2-methylphenyl)-2-[(2-chloroacetyl)amino]acetamide (CAS 756859-07-1) is a chemical compound with the molecular formula C11H12BrClN2O2 and a molecular weight of 319.58 g/mol. IUPAC name: N-(4-bromo-2-methylphenyl)-2-[(2-chloroacetyl)amino]acetamide. InChIKey: APRUFSPQGDJZOF-UHFFFAOYSA-N.
| Molecular formula | C11H12BrClN2O2 |
|---|---|
| Molecular weight | 319.58 g/mol |
| IUPAC name | N-(4-bromo-2-methylphenyl)-2-[(2-chloroacetyl)amino]acetamide |
| InChIKey | APRUFSPQGDJZOF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)NC(=O)CNC(=O)CCl |
Computed by PubChem (NCBI)