CAS 1423025-39-1 is the registry number for (7-Bromoquinolin-6-yl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(7-bromoquinolin-6-yl)methanamine;dihydrochloride (CAS 1423025-39-1) is a chemical compound with the molecular formula C10H11BrCl2N2 and a molecular weight of 310.01 g/mol. IUPAC name: (7-bromoquinolin-6-yl)methanamine;dihydrochloride. InChIKey: XAMKRYSLQVBTGT-UHFFFAOYSA-N.
| Molecular formula | C10H11BrCl2N2 |
|---|---|
| Molecular weight | 310.01 g/mol |
| IUPAC name | (7-bromoquinolin-6-yl)methanamine;dihydrochloride |
| InChIKey | XAMKRYSLQVBTGT-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(C=C2N=C1)Br)CN.Cl.Cl |
Computed by PubChem (NCBI)