CAS 1909313-08-1 is the registry number for 6-Bromonaphthalene-1,2-diamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
6-bromonaphthalene-1,2-diamine;dihydrochloride (CAS 1909313-08-1) is a chemical compound with the molecular formula C10H11BrCl2N2 and a molecular weight of 310.01 g/mol. IUPAC name: 6-bromonaphthalene-1,2-diamine;dihydrochloride. InChIKey: POYRLPVABGJSSW-UHFFFAOYSA-N.
| Molecular formula | C10H11BrCl2N2 |
|---|---|
| Molecular weight | 310.01 g/mol |
| IUPAC name | 6-bromonaphthalene-1,2-diamine;dihydrochloride |
| InChIKey | POYRLPVABGJSSW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N)N)C=C1Br.Cl.Cl |
Computed by PubChem (NCBI)