CAS 1423025-69-7 appears in our catalog under these names: N-(2-Aminoethyl)-N-methylthiophene-2-sulfonamide hydrochloride, 95%, N-(2-Aminoethyl)-N-methylthiophene-2-sulfonamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
N-(2-aminoethyl)-N-methylthiophene-2-sulfonamide;hydrochloride (CAS 1423025-69-7) is a chemical compound with the molecular formula C7H13ClN2O2S2 and a molecular weight of 256.8 g/mol. IUPAC name: N-(2-aminoethyl)-N-methylthiophene-2-sulfonamide;hydrochloride. InChIKey: BYEYHSGWHYGXRL-UHFFFAOYSA-N.
| Molecular formula | C7H13ClN2O2S2 |
|---|---|
| Molecular weight | 256.8 g/mol |
| IUPAC name | N-(2-aminoethyl)-N-methylthiophene-2-sulfonamide;hydrochloride |
| InChIKey | BYEYHSGWHYGXRL-UHFFFAOYSA-N |
| SMILES | CN(CCN)S(=O)(=O)C1=CC=CS1.Cl |
Computed by PubChem (NCBI)