CAS 1590754-24-7 is the registry number for N-(3-Aminopropyl)thiophene-2-sulfonamide hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-aminopropyl)thiophene-2-sulfonamide;hydrochloride (CAS 1590754-24-7) is a chemical compound with the molecular formula C7H13ClN2O2S2 and a molecular weight of 256.8 g/mol. IUPAC name: N-(3-aminopropyl)thiophene-2-sulfonamide;hydrochloride. InChIKey: ZQRZWKBVNMEQDP-UHFFFAOYSA-N.
| Molecular formula | C7H13ClN2O2S2 |
|---|---|
| Molecular weight | 256.8 g/mol |
| IUPAC name | N-(3-aminopropyl)thiophene-2-sulfonamide;hydrochloride |
| InChIKey | ZQRZWKBVNMEQDP-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)S(=O)(=O)NCCCN.Cl |
Computed by PubChem (NCBI)