CAS 1423026-07-6 is the registry number for 2-Methyl-1,1-dioxo-1-benzothiophen-3-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-methyl-1,1-dioxo-1-benzothiophen-3-amine (CAS 1423026-07-6) is a chemical compound with the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. IUPAC name: 2-methyl-1,1-dioxo-1-benzothiophen-3-amine. InChIKey: NPOTZCAVWDMPNM-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2S |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | 2-methyl-1,1-dioxo-1-benzothiophen-3-amine |
| InChIKey | NPOTZCAVWDMPNM-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2S1(=O)=O)N |
Computed by PubChem (NCBI)