Products 1423026-82-7

CAS 1423026-82-7 is the registry number for 1-(2-(2-Chlorophenoxy)ethyl)-6-oxo-1,6-dihydropyridine-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-[2-(2-chlorophenoxy)ethyl]-6-oxopyridine-3-carboxylic acid (CAS 1423026-82-7) is a chemical compound with the molecular formula C14H12ClNO4 and a molecular weight of 293.70 g/mol. IUPAC name: 1-[2-(2-chlorophenoxy)ethyl]-6-oxopyridine-3-carboxylic acid. InChIKey: IDRIRUMNBHQSQW-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12ClNO4
Molecular weight293.70 g/mol
IUPAC name1-[2-(2-chlorophenoxy)ethyl]-6-oxopyridine-3-carboxylic acid
InChIKeyIDRIRUMNBHQSQW-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)OCCN2C=C(C=CC2=O)C(=O)O)Cl

Computed by PubChem (NCBI)