Products 2060052-79-9

CAS 2060052-79-9 is the registry number for 6-(2-(2-Chlorophenoxy)ethoxy)pyridine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

6-[2-(2-chlorophenoxy)ethoxy]pyridine-2-carboxylic acid (CAS 2060052-79-9) is a chemical compound with the molecular formula C14H12ClNO4 and a molecular weight of 293.70 g/mol. IUPAC name: 6-[2-(2-chlorophenoxy)ethoxy]pyridine-2-carboxylic acid. InChIKey: DBNQFEZYCKQHQG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12ClNO4
Molecular weight293.70 g/mol
IUPAC name6-[2-(2-chlorophenoxy)ethoxy]pyridine-2-carboxylic acid
InChIKeyDBNQFEZYCKQHQG-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)OCCOC2=CC=CC(=N2)C(=O)O)Cl

Computed by PubChem (NCBI)