CAS 1423027-13-7 appears in our catalog under these names: 6-methyl-1,4-diazabicyclo(2.2.2)octane-2-carboxylic acid dihydrochloride, 98%, 6-Methyl-1,4-diazabicyclo(2.2.2)octane-2-carboxylic acid dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
6-methyl-1,4-diazabicyclo[2.2.2]octane-2-carboxylic acid;dihydrochloride (CAS 1423027-13-7) is a chemical compound with the molecular formula C8H16Cl2N2O2 and a molecular weight of 243.13 g/mol. IUPAC name: 6-methyl-1,4-diazabicyclo[2.2.2]octane-2-carboxylic acid;dihydrochloride. InChIKey: WLZXURQGVOTGIF-UHFFFAOYSA-N.
| Molecular formula | C8H16Cl2N2O2 |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 6-methyl-1,4-diazabicyclo[2.2.2]octane-2-carboxylic acid;dihydrochloride |
| InChIKey | WLZXURQGVOTGIF-UHFFFAOYSA-N |
| SMILES | CC1CN2CCN1C(C2)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)