Products 1450977-70-4

CAS 1450977-70-4 is the registry number for 1-(Piperazin-1-yl)cyclopropane-1-carboxylic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1-piperazin-1-ylcyclopropane-1-carboxylic acid;dihydrochloride (CAS 1450977-70-4) is a chemical compound with the molecular formula C8H16Cl2N2O2 and a molecular weight of 243.13 g/mol. IUPAC name: 1-piperazin-1-ylcyclopropane-1-carboxylic acid;dihydrochloride. InChIKey: VWXOSTXVTNFJOJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16Cl2N2O2
Molecular weight243.13 g/mol
IUPAC name1-piperazin-1-ylcyclopropane-1-carboxylic acid;dihydrochloride
InChIKeyVWXOSTXVTNFJOJ-UHFFFAOYSA-N
SMILESC1CC1(C(=O)O)N2CCNCC2.Cl.Cl

Computed by PubChem (NCBI)