CAS 1423029-48-4 appears in our catalog under these names: 2-(Methylamino)-2-(pyridin-4-yl)propanamide dihydrochloride, 2-(Methylamino)-2-(pyridin-4-yl)propanamide dihydrochloride, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g, 10g, 5g.
2-(methylamino)-2-pyridin-4-ylpropanamide;dihydrochloride (CAS 1423029-48-4) is a chemical compound with the molecular formula C9H15Cl2N3O and a molecular weight of 252.14 g/mol. IUPAC name: 2-(methylamino)-2-pyridin-4-ylpropanamide;dihydrochloride. InChIKey: INBYSOHVPDILJK-UHFFFAOYSA-N.
| Molecular formula | C9H15Cl2N3O |
|---|---|
| Molecular weight | 252.14 g/mol |
| IUPAC name | 2-(methylamino)-2-pyridin-4-ylpropanamide;dihydrochloride |
| InChIKey | INBYSOHVPDILJK-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=NC=C1)(C(=O)N)NC.Cl.Cl |
Computed by PubChem (NCBI)