CAS 2060033-39-6 appears in our catalog under these names: 6-(Aminomethyl)-2-cyclobutyl-3,4-dihydropyrimidin-4-one dihydrochloride, 95%, 6-(Aminomethyl)-2-cyclobutyl-3,4-dihydropyrimidin-4-one dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(aminomethyl)-2-cyclobutyl-1H-pyrimidin-6-one;dihydrochloride (CAS 2060033-39-6) is a chemical compound with the molecular formula C9H15Cl2N3O and a molecular weight of 252.14 g/mol. IUPAC name: 4-(aminomethyl)-2-cyclobutyl-1H-pyrimidin-6-one;dihydrochloride. InChIKey: OOXODUOBZYQEKY-UHFFFAOYSA-N.
| Molecular formula | C9H15Cl2N3O |
|---|---|
| Molecular weight | 252.14 g/mol |
| IUPAC name | 4-(aminomethyl)-2-cyclobutyl-1H-pyrimidin-6-one;dihydrochloride |
| InChIKey | OOXODUOBZYQEKY-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C2=NC(=CC(=O)N2)CN.Cl.Cl |
Computed by PubChem (NCBI)