CAS 1423029-53-1 is the registry number for N-(2-Aminoethyl)-N'-(pyridin-2-ylmethyl)ethanediamide Dihydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 50mg, 0,5g.
N-(2-aminoethyl)-N'-(pyridin-2-ylmethyl)oxamide;dihydrochloride (CAS 1423029-53-1) is a chemical compound with the molecular formula C10H16Cl2N4O2 and a molecular weight of 295.16 g/mol. IUPAC name: N-(2-aminoethyl)-N'-(pyridin-2-ylmethyl)oxamide;dihydrochloride. InChIKey: XJPCIYOWVVKKNT-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N4O2 |
|---|---|
| Molecular weight | 295.16 g/mol |
| IUPAC name | N-(2-aminoethyl)-N'-(pyridin-2-ylmethyl)oxamide;dihydrochloride |
| InChIKey | XJPCIYOWVVKKNT-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CNC(=O)C(=O)NCCN.Cl.Cl |
Computed by PubChem (NCBI)