CAS 412355-82-9 is the registry number for 1-(5-Nitropyridin-2-yl)piperidin-4-amine dihydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(5-nitro-2-pyridinyl)piperidin-4-amine;dihydrochloride (CAS 412355-82-9) is a chemical compound with the molecular formula C10H16Cl2N4O2 and a molecular weight of 295.16 g/mol. IUPAC name: 1-(5-nitro-2-pyridinyl)piperidin-4-amine;dihydrochloride. InChIKey: JOCRHSZWXXKTMA-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N4O2 |
|---|---|
| Molecular weight | 295.16 g/mol |
| IUPAC name | 1-(5-nitro-2-pyridinyl)piperidin-4-amine;dihydrochloride |
| InChIKey | JOCRHSZWXXKTMA-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)C2=NC=C(C=C2)[N+](=O)[O-].Cl.Cl |
Computed by PubChem (NCBI)