CAS 1423031-78-0 appears in our catalog under these names: 4-((1-Methyl-1H-1,2,4-triazol-5-yl)methoxy)benzene-1-sulfonyl chloride, 95%, 4-((1-Methyl-1H-1,2,4-triazol-5-yl)methoxy)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzenesulfonyl chloride (CAS 1423031-78-0) is a chemical compound with the molecular formula C10H10ClN3O3S and a molecular weight of 287.72 g/mol. IUPAC name: 4-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzenesulfonyl chloride. InChIKey: ZQPFOUNCXUXDSF-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3O3S |
|---|---|
| Molecular weight | 287.72 g/mol |
| IUPAC name | 4-[(2-methyl-1,2,4-triazol-3-yl)methoxy]benzenesulfonyl chloride |
| InChIKey | ZQPFOUNCXUXDSF-UHFFFAOYSA-N |
| SMILES | CN1C(=NC=N1)COC2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)