CAS 6599-87-7 is the registry number for 4-Acetoxy-TEMPO. Offered by: TRC. Available pack sizes: 1g.
N-[(2-chloro-5-nitrophenyl)carbamothioyl]propanamide (CAS 6599-87-7) is a chemical compound with the molecular formula C10H10ClN3O3S and a molecular weight of 287.72 g/mol. IUPAC name: N-[(2-chloro-5-nitrophenyl)carbamothioyl]propanamide. InChIKey: KUSPWCIDOHLMEG-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3O3S |
|---|---|
| Molecular weight | 287.72 g/mol |
| IUPAC name | N-[(2-chloro-5-nitrophenyl)carbamothioyl]propanamide |
| InChIKey | KUSPWCIDOHLMEG-UHFFFAOYSA-N |
| SMILES | CCC(=O)NC(=S)NC1=C(C=CC(=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)