Products 1423034-47-2
CAS 1423034-47-2 is the registry number for 5-​chloro-​2,​3-​dihydro-​N-​methyl-​benzo(b)​thiophen-​3-​amine 1,​1-​dioxide hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-chloro-N-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride (CAS 1423034-47-2) is a chemical compound with the molecular formula C9H11Cl2NO2S and a molecular weight of 268.16 g/mol. IUPAC name: 5-chloro-N-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride. InChIKey: SBVVTCOCNYLBAE-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO2S |
|---|---|
| Molecular weight | 268.16 g/mol |
| IUPAC name | 5-chloro-N-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride |
| InChIKey | SBVVTCOCNYLBAE-UHFFFAOYSA-N |
| SMILES | CNC1CS(=O)(=O)C2=C1C=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)