CAS 950239-71-1 is the registry number for 1-(3,4-Dichlorophenyl)-N-ethylmethanesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(3,4-dichlorophenyl)-N-ethylmethanesulfonamide (CAS 950239-71-1) is a chemical compound with the molecular formula C9H11Cl2NO2S and a molecular weight of 268.16 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-N-ethylmethanesulfonamide. InChIKey: RVMOGRXUSPLFQR-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO2S |
|---|---|
| Molecular weight | 268.16 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-N-ethylmethanesulfonamide |
| InChIKey | RVMOGRXUSPLFQR-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)CC1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)