CAS 1423034-48-3 appears in our catalog under these names: 2-(3-Chloropropyl)-5-(trifluoromethyl)-1,3,4-oxadiazole, 2-(3-Chloropropyl)-5-(trifluoromethyl)-1,3,4-oxadiazole, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
2-(3-chloropropyl)-5-(trifluoromethyl)-1,3,4-oxadiazole (CAS 1423034-48-3) is a chemical compound with the molecular formula C6H6ClF3N2O and a molecular weight of 214.57 g/mol. IUPAC name: 2-(3-chloropropyl)-5-(trifluoromethyl)-1,3,4-oxadiazole. InChIKey: KLCCNFZHWYCUNE-UHFFFAOYSA-N.
| Molecular formula | C6H6ClF3N2O |
|---|---|
| Molecular weight | 214.57 g/mol |
| IUPAC name | 2-(3-chloropropyl)-5-(trifluoromethyl)-1,3,4-oxadiazole |
| InChIKey | KLCCNFZHWYCUNE-UHFFFAOYSA-N |
| SMILES | C(CC1=NN=C(O1)C(F)(F)F)CCl |
Computed by PubChem (NCBI)