Products 923688-29-3
CAS 923688-29-3 is the registry number for 1-(5-Chloro-1-methyl-1H-imidazol-2-yl)-2,2,2-trifluoroethan-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(5-chloro-1-methylimidazol-2-yl)-2,2,2-trifluoroethanol (CAS 923688-29-3) is a chemical compound with the molecular formula C6H6ClF3N2O and a molecular weight of 214.57 g/mol. IUPAC name: 1-(5-chloro-1-methylimidazol-2-yl)-2,2,2-trifluoroethanol. InChIKey: CEWITLLRZXZVFH-UHFFFAOYSA-N.
| Molecular formula | C6H6ClF3N2O |
|---|---|
| Molecular weight | 214.57 g/mol |
| IUPAC name | 1-(5-chloro-1-methylimidazol-2-yl)-2,2,2-trifluoroethanol |
| InChIKey | CEWITLLRZXZVFH-UHFFFAOYSA-N |
| SMILES | CN1C(=CN=C1C(C(F)(F)F)O)Cl |
Computed by PubChem (NCBI)