CAS 1423037-44-8 is the registry number for N-Isopropyl L-Z-isoleucinamide, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Benzyl N-[(2S,3S)-3-methyl-1-oxo-1-(propan-2-ylamino)pentan-2-yl]carbamate (CAS 1423037-44-8) is a chemical compound with the molecular formula C17H26N2O3 and a molecular weight of 306.4 g/mol. IUPAC name: benzyl N-[(2S,3S)-3-methyl-1-oxo-1-(propan-2-ylamino)pentan-2-yl]carbamate. InChIKey: ASGOSUHDCGODBA-ZFWWWQNUSA-N.
| Molecular formula | C17H26N2O3 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | benzyl N-[(2S,3S)-3-methyl-1-oxo-1-(propan-2-ylamino)pentan-2-yl]carbamate |
| InChIKey | ASGOSUHDCGODBA-ZFWWWQNUSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)NC(C)C)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)