Products 1423037-51-7

CAS 1423037-51-7 is the registry number for N-Propyl L-Z-isoleucinamide, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[3-methyl-1-oxo-1-(propylamino)pentan-2-yl]carbamate (CAS 1423037-51-7) is a chemical compound with the molecular formula C17H26N2O3 and a molecular weight of 306.4 g/mol. IUPAC name: benzyl N-[3-methyl-1-oxo-1-(propylamino)pentan-2-yl]carbamate. InChIKey: LZYZIYPOFBSJPM-UHFFFAOYSA-N.

Identity
Molecular formulaC17H26N2O3
Molecular weight306.4 g/mol
IUPAC namebenzyl N-[3-methyl-1-oxo-1-(propylamino)pentan-2-yl]carbamate
InChIKeyLZYZIYPOFBSJPM-UHFFFAOYSA-N
SMILESCCCNC(=O)C(C(C)CC)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)