Products 1423040-64-5
CAS 1423040-64-5 is the registry number for (3R)-1-((3-Phenyl-1,2,4-oxadiazol-5-yl)methyl)pyrrolidin-3-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3R)-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]pyrrolidin-3-ol (CAS 1423040-64-5) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: (3R)-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]pyrrolidin-3-ol. InChIKey: FQHRNVUXCKTULP-LLVKDONJSA-N.
| Molecular formula | C13H15N3O2 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | (3R)-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]pyrrolidin-3-ol |
| InChIKey | FQHRNVUXCKTULP-LLVKDONJSA-N |
| SMILES | C1CN(C[C@@H]1O)CC2=NC(=NO2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)