CAS 1423040-75-8 appears in our catalog under these names: (1S)-1-(4-Bromothiophen-2-yl)-2,2,2-trifluoroethan-1-ol, 95%, (1S)-1-(4-Bromothiophen-2-yl)-2,2,2-trifluoroethan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(1S)-1-(4-bromothiophen-2-yl)-2,2,2-trifluoroethanol (CAS 1423040-75-8) is a chemical compound with the molecular formula C6H4BrF3OS and a molecular weight of 261.06 g/mol. IUPAC name: (1S)-1-(4-bromothiophen-2-yl)-2,2,2-trifluoroethanol. InChIKey: LQPGUZRVDBHBJA-RXMQYKEDSA-N.
| Molecular formula | C6H4BrF3OS |
|---|---|
| Molecular weight | 261.06 g/mol |
| IUPAC name | (1S)-1-(4-bromothiophen-2-yl)-2,2,2-trifluoroethanol |
| InChIKey | LQPGUZRVDBHBJA-RXMQYKEDSA-N |
| SMILES | C1=C(SC=C1Br)[C@H](C(F)(F)F)O |
Computed by PubChem (NCBI)