CAS 35304-69-9 appears in our catalog under these names: 1-(5-Bromothiophen-2-yl)-2,2,2-trifluoroethanol, 98%, 5-Bromo-α-(trifluoromethyl)-2-thiophenemethanol, 95%, 95%, 1-(5-Bromothiophen-2-yl)-2,2,2-trifluoroethan-1-ol, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 250mg, 100mg, 5g, 1g, 10g.
1-(5-bromothiophen-2-yl)-2,2,2-trifluoroethanol (CAS 35304-69-9) is a chemical compound with the molecular formula C6H4BrF3OS and a molecular weight of 261.06 g/mol. IUPAC name: 1-(5-bromothiophen-2-yl)-2,2,2-trifluoroethanol. InChIKey: XGACUFQKJSMHLR-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF3OS |
|---|---|
| Molecular weight | 261.06 g/mol |
| IUPAC name | 1-(5-bromothiophen-2-yl)-2,2,2-trifluoroethanol |
| InChIKey | XGACUFQKJSMHLR-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Br)C(C(F)(F)F)O |
Computed by PubChem (NCBI)