CAS 1423250-34-3 is the registry number for 5-Bromo-N-(1-methyl-1H-1,2,4-triazol-5-yl)nicotinamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-(2-methyl-1,2,4-triazol-3-yl)pyridine-3-carboxamide (CAS 1423250-34-3) is a chemical compound with the molecular formula C9H8BrN5O and a molecular weight of 282.10 g/mol. IUPAC name: 5-bromo-N-(2-methyl-1,2,4-triazol-3-yl)pyridine-3-carboxamide. InChIKey: QMVNUTYKALVTBZ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN5O |
|---|---|
| Molecular weight | 282.10 g/mol |
| IUPAC name | 5-bromo-N-(2-methyl-1,2,4-triazol-3-yl)pyridine-3-carboxamide |
| InChIKey | QMVNUTYKALVTBZ-UHFFFAOYSA-N |
| SMILES | CN1C(=NC=N1)NC(=O)C2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)