CAS 1856778-43-2 is the registry number for 5-Bromo-N-(4-methyl-4H-1,2,4-triazol-3-yl)pyridine-2-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-bromo-N-(4-methyl-1,2,4-triazol-3-yl)pyridine-2-carboxamide (CAS 1856778-43-2) is a chemical compound with the molecular formula C9H8BrN5O and a molecular weight of 282.10 g/mol. IUPAC name: 5-bromo-N-(4-methyl-1,2,4-triazol-3-yl)pyridine-2-carboxamide. InChIKey: YENKGLSUMWJXPX-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN5O |
|---|---|
| Molecular weight | 282.10 g/mol |
| IUPAC name | 5-bromo-N-(4-methyl-1,2,4-triazol-3-yl)pyridine-2-carboxamide |
| InChIKey | YENKGLSUMWJXPX-UHFFFAOYSA-N |
| SMILES | CN1C=NN=C1NC(=O)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)