CAS 142326-92-9 is the registry number for L-703717. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-chloro-4-hydroxy-3-[3-[(4-methoxyphenyl)methyl]phenyl]-1H-quinolin-2-one (CAS 142326-92-9) is a chemical compound with the molecular formula C23H18ClNO3 and a molecular weight of 391.8 g/mol. IUPAC name: 7-chloro-4-hydroxy-3-[3-[(4-methoxyphenyl)methyl]phenyl]-1H-quinolin-2-one. InChIKey: ITPRBCDKYPSWNW-UHFFFAOYSA-N.
| Molecular formula | C23H18ClNO3 |
|---|---|
| Molecular weight | 391.8 g/mol |
| IUPAC name | 7-chloro-4-hydroxy-3-[3-[(4-methoxyphenyl)methyl]phenyl]-1H-quinolin-2-one |
| InChIKey | ITPRBCDKYPSWNW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CC2=CC(=CC=C2)C3=C(C4=C(C=C(C=C4)Cl)NC3=O)O |
Computed by PubChem (NCBI)