CAS 946386-82-9 is the registry number for 2-(3,4-dimethoxyphenyl)-3-((4-chlorophenyl)amino)inden-1-one. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg.
3-(4-chloroanilino)-2-(3,4-dimethoxyphenyl)inden-1-one (CAS 946386-82-9) is a chemical compound with the molecular formula C23H18ClNO3 and a molecular weight of 391.8 g/mol. IUPAC name: 3-(4-chloroanilino)-2-(3,4-dimethoxyphenyl)inden-1-one. InChIKey: XOUMSPDUSLBQSK-UHFFFAOYSA-N.
| Molecular formula | C23H18ClNO3 |
|---|---|
| Molecular weight | 391.8 g/mol |
| IUPAC name | 3-(4-chloroanilino)-2-(3,4-dimethoxyphenyl)inden-1-one |
| InChIKey | XOUMSPDUSLBQSK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(C3=CC=CC=C3C2=O)NC4=CC=C(C=C4)Cl)OC |
Computed by PubChem (NCBI)