CAS 1423506-57-3 is the registry number for N-Methyl-3-(2-methyl-1,3-thiazol-4-yl)benzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-methyl-3-(2-methyl-1,3-thiazol-4-yl)benzamide (CAS 1423506-57-3) is a chemical compound with the molecular formula C12H12N2OS and a molecular weight of 232.30 g/mol. IUPAC name: N-methyl-3-(2-methyl-1,3-thiazol-4-yl)benzamide. InChIKey: IPYMTJMGMIKOJY-UHFFFAOYSA-N.
| Molecular formula | C12H12N2OS |
|---|---|
| Molecular weight | 232.30 g/mol |
| IUPAC name | N-methyl-3-(2-methyl-1,3-thiazol-4-yl)benzamide |
| InChIKey | IPYMTJMGMIKOJY-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC(=CC=C2)C(=O)NC |
Computed by PubChem (NCBI)