CAS 1428139-65-4 is the registry number for 2-Amino-4-(5-methyl-2-thienyl)-6-oxocyclohex-1-ene-1-carbonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-amino-4-(5-methylthiophen-2-yl)-6-oxocyclohexene-1-carbonitrile (CAS 1428139-65-4) is a chemical compound with the molecular formula C12H12N2OS and a molecular weight of 232.30 g/mol. IUPAC name: 2-amino-4-(5-methylthiophen-2-yl)-6-oxocyclohexene-1-carbonitrile. InChIKey: VOMMAYXANWXBDW-UHFFFAOYSA-N.
| Molecular formula | C12H12N2OS |
|---|---|
| Molecular weight | 232.30 g/mol |
| IUPAC name | 2-amino-4-(5-methylthiophen-2-yl)-6-oxocyclohexene-1-carbonitrile |
| InChIKey | VOMMAYXANWXBDW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)C2CC(=C(C(=O)C2)C#N)N |
Computed by PubChem (NCBI)