Products 14236-13-6
CAS 14236-13-6 is the registry number for 4-(Tert-butyl)phthalic acid, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-tert-butylphthalic acid (CAS 14236-13-6) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 4-tert-butylphthalic acid. InChIKey: OZHQCWZLIYAJBL-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 4-tert-butylphthalic acid |
| InChIKey | OZHQCWZLIYAJBL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-tert-Butylphthalic acid, 1,2-Benzenedicarboxylic acid, 4-(1,1-dimethylethyl)-, OZHQCWZLIYAJBL-UHFFFAOYSA-N, 4-(tert-Butyl)phthalic acid, 4-tert-butylbenzene-1,2-dicarboxylic acid, 4-t-butylphthalic acid, 4-tertbutylphthalic acid, 4-(tert-Butyl)phthalicacid, 4-tert-Butylphthalic acid #, 4-(tert-butyl)benzene-1,2-dicarboxylic acid