Products 1423700-57-5
CAS 1423700-57-5 is the registry number for Ethyl 2-(4-Bromophenyl)benzofuran-3-carboxylate, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 2-(4-bromophenyl)-1-benzofuran-3-carboxylate (CAS 1423700-57-5) is a chemical compound with the molecular formula C17H13BrO3 and a molecular weight of 345.2 g/mol. IUPAC name: ethyl 2-(4-bromophenyl)-1-benzofuran-3-carboxylate. InChIKey: WVGZMLFPWJTDEX-UHFFFAOYSA-N.
| Molecular formula | C17H13BrO3 |
|---|---|
| Molecular weight | 345.2 g/mol |
| IUPAC name | ethyl 2-(4-bromophenyl)-1-benzofuran-3-carboxylate |
| InChIKey | WVGZMLFPWJTDEX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC2=CC=CC=C21)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)